CAS 115581-09-4 appears in our catalog under these names: 5-Bromoquinolin-6-ol, 95%, 5-Bromoquinolin-6-ol, 98%, 98%, 5-Bromoquinolin-6-ol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g.
5-bromoquinolin-6-ol (CAS 115581-09-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-bromoquinolin-6-ol. InChIKey: HQEFDTSINGDBKQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-bromoquinolin-6-ol |
| InChIKey | HQEFDTSINGDBKQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2Br)O)N=C1 |
Computed by PubChem (NCBI)