CAS 115588-13-1 appears in our catalog under these names: H–Gly–D–Gln–OH, Glycyl-D-glutamine, 97%, H-Gly-D-Gln-OH, Glycyl-D-Glutamine, 95%, 95%, Glycyl-D-glutamine, 95%. Offered by: GLPBio, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 1000mg, 100mg.
(2R)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid (CAS 115588-13-1) is a chemical compound with the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. IUPAC name: (2R)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid. InChIKey: PNMUAGGSDZXTHX-SCSAIBSYSA-N.
| Molecular formula | C7H13N3O4 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | (2R)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid |
| InChIKey | PNMUAGGSDZXTHX-SCSAIBSYSA-N |
| SMILES | C(CC(=O)N)[C@H](C(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)