CAS 20881-80-5 is the registry number for Methyl 4-Azido-4,6-dideoxy-alpha-D-mannopyranoside. Offered by: TRC. Available pack sizes: 5g.
(2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol (CAS 20881-80-5) is a chemical compound with the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. IUPAC name: (2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol. InChIKey: PKXUFEYHGZHRPK-VEIUFWFVSA-N.
| Molecular formula | C7H13N3O4 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | (2S,3S,4S,5S,6R)-5-azido-2-methoxy-6-methyloxane-3,4-diol |
| InChIKey | PKXUFEYHGZHRPK-VEIUFWFVSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)