Products 38937-80-3

CAS 38937-80-3 is the registry number for H-Gly-Gly-Sar-OH. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-[[2-[(2-aminoacetyl)amino]acetyl]-methylamino]acetic acid (CAS 38937-80-3) is a chemical compound with the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. IUPAC name: 2-[[2-[(2-aminoacetyl)amino]acetyl]-methylamino]acetic acid. InChIKey: WTUVOOODVFIARR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13N3O4
Molecular weight203.20 g/mol
IUPAC name2-[[2-[(2-aminoacetyl)amino]acetyl]-methylamino]acetic acid
InChIKeyWTUVOOODVFIARR-UHFFFAOYSA-N
SMILESCN(CC(=O)O)C(=O)CNC(=O)CN

Computed by PubChem (NCBI)