Products 1156079-14-9

CAS 1156079-14-9 is the registry number for Methyl 6-((3-hydroxyphenyl)formamido)hexanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 6-[(3-hydroxybenzoyl)amino]hexanoate (CAS 1156079-14-9) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: methyl 6-[(3-hydroxybenzoyl)amino]hexanoate. InChIKey: BXZRDKACESNYKH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO4
Molecular weight265.30 g/mol
IUPAC namemethyl 6-[(3-hydroxybenzoyl)amino]hexanoate
InChIKeyBXZRDKACESNYKH-UHFFFAOYSA-N
SMILESCOC(=O)CCCCCNC(=O)C1=CC(=CC=C1)O

Computed by PubChem (NCBI)