CAS 1156266-78-2 appears in our catalog under these names: (1-(4-Chlorophenyl)-2,2-dimethylpropyl)(methyl)amine, 95%, (1-(4-Chlorophenyl)-2,2-dimethylpropyl)(methyl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-chlorophenyl)-N,2,2-trimethylpropan-1-amine (CAS 1156266-78-2) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 1-(4-chlorophenyl)-N,2,2-trimethylpropan-1-amine. InChIKey: QRFKGGNCWLRVQZ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-N,2,2-trimethylpropan-1-amine |
| InChIKey | QRFKGGNCWLRVQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=C(C=C1)Cl)NC |
Computed by PubChem (NCBI)