CAS 1156389-00-2 appears in our catalog under these names: 6-Bromo-7-fluoro-3,4-dihydroquinolin-2(1H)-one, 95+%, 6-Bromo-7-fluoro-3,4-dihydroquinolin-2(1H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-bromo-7-fluoro-3,4-dihydro-1H-quinolin-2-one (CAS 1156389-00-2) is a chemical compound with the molecular formula C9H7BrFNO and a molecular weight of 244.06 g/mol. IUPAC name: 6-bromo-7-fluoro-3,4-dihydro-1H-quinolin-2-one. InChIKey: QHBQAFBBDSHWLQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 6-bromo-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | QHBQAFBBDSHWLQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=CC(=C(C=C21)Br)F |
Computed by PubChem (NCBI)