CAS 1339218-02-8 is the registry number for 4-(4-Bromo-2-fluorophenyl)azetidin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-(4-bromo-2-fluorophenyl)azetidin-2-one (CAS 1339218-02-8) is a chemical compound with the molecular formula C9H7BrFNO and a molecular weight of 244.06 g/mol. IUPAC name: 4-(4-bromo-2-fluorophenyl)azetidin-2-one. InChIKey: VIFHHADNTXIQSU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 4-(4-bromo-2-fluorophenyl)azetidin-2-one |
| InChIKey | VIFHHADNTXIQSU-UHFFFAOYSA-N |
| SMILES | C1C(NC1=O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)