CAS 1341674-79-0 appears in our catalog under these names: 7-Bromo-5-fluoro-1,2,3,4-tetrahydroisoquinolin-1-one, 95%, 7-Bromo-5-fluoro-3,4-dihydroisoquinolin-1(2H)-one, 95%, 7-Bromo-5-fluoro-3,4-dihydroisoquinolin-1(2H)-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 50mg, 0,5g.
7-bromo-5-fluoro-3,4-dihydro-2H-isoquinolin-1-one (CAS 1341674-79-0) is a chemical compound with the molecular formula C9H7BrFNO and a molecular weight of 244.06 g/mol. IUPAC name: 7-bromo-5-fluoro-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: SWDNXUOHYHBRNG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 7-bromo-5-fluoro-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | SWDNXUOHYHBRNG-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C(=CC(=C2)Br)F |
Computed by PubChem (NCBI)