Products 2386045-42-5
CAS 2386045-42-5 is the registry number for 4-(Bromomethyl)-2-fluoro-6-methoxybenzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(bromomethyl)-2-fluoro-6-methoxybenzonitrile (CAS 2386045-42-5) is a chemical compound with the molecular formula C9H7BrFNO and a molecular weight of 244.06 g/mol. IUPAC name: 4-(bromomethyl)-2-fluoro-6-methoxybenzonitrile. InChIKey: FTTQXOHVCMASAK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 4-(bromomethyl)-2-fluoro-6-methoxybenzonitrile |
| InChIKey | FTTQXOHVCMASAK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CBr)F)C#N |
Computed by PubChem (NCBI)