CAS 115664-39-6 appears in our catalog under these names: Detomidine Impurity 6（3-Carboxy Detomidine）, 3-((1H-Imidazol-5-yl)methyl)-2-methylbenzoic acid, 98%, 3-Carboxy Detomidine, >95% (HPLC), Detomidine carboxylic acid. Offered by: Hubei YoungXin, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 5mg, 5 mg.
3-(1H-imidazol-5-ylmethyl)-2-methylbenzoic acid (CAS 115664-39-6) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3-(1H-imidazol-5-ylmethyl)-2-methylbenzoic acid. InChIKey: UYLYCKVCJPJDEL-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3-(1H-imidazol-5-ylmethyl)-2-methylbenzoic acid |
| InChIKey | UYLYCKVCJPJDEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C(=O)O)CC2=CN=CN2 |
Computed by PubChem (NCBI)