Products 1346605-14-8
CAS 1346605-14-8 is the registry number for 3-Carboxy Detomidine-13C,15N2. Offered by: TRC. Available pack sizes: 50mg.
3-((213C,1,3-15N2)1H-imidazol-5-ylmethyl)-2-methylbenzoic acid (CAS 1346605-14-8) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 219.21 g/mol. IUPAC name: 3-((213C,1,3-15N2)1H-imidazol-5-ylmethyl)-2-methylbenzoic acid. InChIKey: UYLYCKVCJPJDEL-BRALYQIWSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | 3-((213C,1,3-15N2)1H-imidazol-5-ylmethyl)-2-methylbenzoic acid |
| InChIKey | UYLYCKVCJPJDEL-BRALYQIWSA-N |
| SMILES | CC1=C(C=CC=C1C(=O)O)CC2=C[15N]=[13CH][15NH]2 |
Computed by PubChem (NCBI)