CAS 1156753-33-1 appears in our catalog under these names: 3-(2,3-Dihydrobenzo(b)(1,4)dioxin-5-yl)isoxazol-5-amine, 95%, 3-(2,3-Dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine (CAS 1156753-33-1) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine. InChIKey: ZFMIZFVCNZMJLV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,2-oxazol-5-amine |
| InChIKey | ZFMIZFVCNZMJLV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)C3=NOC(=C3)N |
Computed by PubChem (NCBI)