CAS 1156923-88-4 is the registry number for 3-(2-Amino-5-bromo-1H-benzo[d]imidazol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-amine (CAS 1156923-88-4) is a chemical compound with the molecular formula C11H12BrN3O2S and a molecular weight of 330.20 g/mol. IUPAC name: 5-bromo-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-amine. InChIKey: QGLFAELCYCEPQY-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O2S |
|---|---|
| Molecular weight | 330.20 g/mol |
| IUPAC name | 5-bromo-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-amine |
| InChIKey | QGLFAELCYCEPQY-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=C(C=C3)Br)N=C2N |
Computed by PubChem (NCBI)