CAS 1187385-77-8 is the registry number for N-Ethyl 4-(4-bromopyrazol-1-yl)benzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
4-(4-bromopyrazol-1-yl)-N-ethylbenzenesulfonamide (CAS 1187385-77-8) is a chemical compound with the molecular formula C11H12BrN3O2S and a molecular weight of 330.20 g/mol. IUPAC name: 4-(4-bromopyrazol-1-yl)-N-ethylbenzenesulfonamide. InChIKey: NKTWKABVQQZWTC-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O2S |
|---|---|
| Molecular weight | 330.20 g/mol |
| IUPAC name | 4-(4-bromopyrazol-1-yl)-N-ethylbenzenesulfonamide |
| InChIKey | NKTWKABVQQZWTC-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC=C(C=C1)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)