Products 52208-11-4

CAS 52208-11-4 is the registry number for 2-(1,3-Dioxoisoindolin-2-yl)ethyl carbamimidothioate hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1,3-dioxoisoindol-2-yl)ethyl carbamimidothioate;hydrobromide (CAS 52208-11-4) is a chemical compound with the molecular formula C11H12BrN3O2S and a molecular weight of 330.20 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)ethyl carbamimidothioate;hydrobromide. InChIKey: RULZBVGLKDQUQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BrN3O2S
Molecular weight330.20 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)ethyl carbamimidothioate;hydrobromide
InChIKeyRULZBVGLKDQUQJ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CCSC(=N)N.Br

Computed by PubChem (NCBI)