CAS 1268702-85-7 is the registry number for N-(4-Bromophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CAS 1268702-85-7) is a chemical compound with the molecular formula C11H12BrN3O2S and a molecular weight of 330.20 g/mol. IUPAC name: N-(4-bromophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide. InChIKey: HVVHMHOAAIILIX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O2S |
|---|---|
| Molecular weight | 330.20 g/mol |
| IUPAC name | N-(4-bromophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| InChIKey | HVVHMHOAAIILIX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)