CAS 1157455-13-4 appears in our catalog under these names: 1-(5-Bromo-2-methylphenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(5-Bromo-2-methylphenyl)-2,5-dimethyl-1H-pyrrole, 98%, 1-(5-Bromo-2-methylphenyl)-2,5-dimethyl-1H-pyrrole, ≥95%, ≥95%, 1-(5-Bromo-2-methylphenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
1-(5-bromo-2-methylphenyl)-2,5-dimethylpyrrole (CAS 1157455-13-4) is a chemical compound with the molecular formula C13H14BrN and a molecular weight of 264.16 g/mol. IUPAC name: 1-(5-bromo-2-methylphenyl)-2,5-dimethylpyrrole. InChIKey: MTQMHNWBQVNWNT-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | 1-(5-bromo-2-methylphenyl)-2,5-dimethylpyrrole |
| InChIKey | MTQMHNWBQVNWNT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)N2C(=CC=C2C)C |
Computed by PubChem (NCBI)