CAS 1493130-82-7 appears in our catalog under these names: 8-Bromo-3-methyl-2,3,4,9-tetrahydro-1H-carbazole, 98%, 8-Bromo-3-methyl-2,3,4,9-tetrahydro-1h-carbazole, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g, 2.5g.
8-bromo-3-methyl-2,3,4,9-tetrahydro-1H-carbazole (CAS 1493130-82-7) is a chemical compound with the molecular formula C13H14BrN and a molecular weight of 264.16 g/mol. IUPAC name: 8-bromo-3-methyl-2,3,4,9-tetrahydro-1H-carbazole. InChIKey: JYIWVPMTAWFTDI-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | 8-bromo-3-methyl-2,3,4,9-tetrahydro-1H-carbazole |
| InChIKey | JYIWVPMTAWFTDI-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C3=C(N2)C(=CC=C3)Br |
Computed by PubChem (NCBI)