CAS 736973-12-9 appears in our catalog under these names: 1-(3-Bromo-4-methylphenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(3-Bromo-4-methylphenyl)-2,5-dimethyl-1H-pyrrole, 98%, 1-(3-Bromo-4-methylphenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrole (CAS 736973-12-9) is a chemical compound with the molecular formula C13H14BrN and a molecular weight of 264.16 g/mol. IUPAC name: 1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrole. InChIKey: FQOXOFKUVDQSQZ-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | 1-(3-bromo-4-methylphenyl)-2,5-dimethylpyrrole |
| InChIKey | FQOXOFKUVDQSQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=CC=C2C)C)Br |
Computed by PubChem (NCBI)