CAS 626603-27-8 is the registry number for 1-(4-bromophenyl)cyclohexane-1-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-bromophenyl)cyclohexane-1-carbonitrile (CAS 626603-27-8) is a chemical compound with the molecular formula C13H14BrN and a molecular weight of 264.16 g/mol. IUPAC name: 1-(4-bromophenyl)cyclohexane-1-carbonitrile. InChIKey: FQJKOWLQDAJQIW-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclohexane-1-carbonitrile |
| InChIKey | FQJKOWLQDAJQIW-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)