CAS 115754-65-9 is the registry number for 3-Amino-6-bromo-2-phenylquinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
3-amino-6-bromo-2-phenylquinazolin-4-one (CAS 115754-65-9) is a chemical compound with the molecular formula C14H10BrN3O and a molecular weight of 316.15 g/mol. IUPAC name: 3-amino-6-bromo-2-phenylquinazolin-4-one. InChIKey: CMTNMFFMRLGVCZ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 3-amino-6-bromo-2-phenylquinazolin-4-one |
| InChIKey | CMTNMFFMRLGVCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Br)C(=O)N2N |
Computed by PubChem (NCBI)