Products 115755-54-9
CAS 115755-54-9 is the registry number for (4-Nitro-phenyl)-piperidin-4-yl-methanone hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
(4-nitrophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 115755-54-9) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: (4-nitrophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: WECADBRGHNQTCN-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | (4-nitrophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | WECADBRGHNQTCN-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)