CAS 1158206-46-2 is the registry number for [(5-Isopropyl-1,3,4-thiadiazol-2-yl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-oxo-2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]acetic acid (CAS 1158206-46-2) is a chemical compound with the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. IUPAC name: 2-oxo-2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]acetic acid. InChIKey: ODTPEZHSRIRMAE-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 2-oxo-2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)amino]acetic acid |
| InChIKey | ODTPEZHSRIRMAE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN=C(S1)NC(=O)C(=O)O |
Computed by PubChem (NCBI)