CAS 25156-39-2 is the registry number for p-Guanidinobenzenesulfonic Acid. Offered by: TRC. Available pack sizes: 10g.
4-(diaminomethylideneamino)benzenesulfonic acid (CAS 25156-39-2) is a chemical compound with the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. IUPAC name: 4-(diaminomethylideneamino)benzenesulfonic acid. InChIKey: BYWLMUBOYOEXTG-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 4-(diaminomethylideneamino)benzenesulfonic acid |
| InChIKey | BYWLMUBOYOEXTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C(N)N)S(=O)(=O)O |
Computed by PubChem (NCBI)