Products 63916-09-6

CAS 63916-09-6 is the registry number for 3-[(4-Amino-6-oxo-1,6-dihydropyrimidin-2-yl)thio]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid (CAS 63916-09-6) is a chemical compound with the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. IUPAC name: 3-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid. InChIKey: AVUZNCBNWOIPHH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9N3O3S
Molecular weight215.23 g/mol
IUPAC name3-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoic acid
InChIKeyAVUZNCBNWOIPHH-UHFFFAOYSA-N
SMILESC1=C(N=C(NC1=O)SCCC(=O)O)N

Computed by PubChem (NCBI)