CAS 790299-37-5 is the registry number for 4-Amino-1-(2-hydroxy-1,3-oxathiolan-5-yl)pyrimidin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-1-(2-hydroxy-1,3-oxathiolan-5-yl)pyrimidin-2-one (CAS 790299-37-5) is a chemical compound with the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. IUPAC name: 4-amino-1-(2-hydroxy-1,3-oxathiolan-5-yl)pyrimidin-2-one. InChIKey: FGFJTJDYPAQVRH-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 4-amino-1-(2-hydroxy-1,3-oxathiolan-5-yl)pyrimidin-2-one |
| InChIKey | FGFJTJDYPAQVRH-UHFFFAOYSA-N |
| SMILES | C1C(OC(S1)O)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)