CAS 1158368-56-9 is the registry number for 1-(4-Nitrobenzoyl)piperidin-4-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(4-aminopiperidin-1-yl)-(4-nitrophenyl)methanone;hydrochloride (CAS 1158368-56-9) is a chemical compound with the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-(4-nitrophenyl)methanone;hydrochloride. InChIKey: GGMUXGLGLWFEIO-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O3 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-(4-nitrophenyl)methanone;hydrochloride |
| InChIKey | GGMUXGLGLWFEIO-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)