CAS 1609400-72-7 is the registry number for (1-[3-(3,4-Dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1609400-72-7) is a chemical compound with the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. IUPAC name: 1-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: QDGBYAQYEPJUKU-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O3 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 1-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | QDGBYAQYEPJUKU-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC(=C(C=C2)OC)OC)N.Cl |
Computed by PubChem (NCBI)