CAS 2410119-23-0 is the registry number for tert-Butyl 2-chloro-4-methoxy-5,7-dihydro-6H-pyrrolo[3,4-d]pyrimidine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chloro-4-methoxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (CAS 2410119-23-0) is a chemical compound with the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. IUPAC name: tert-butyl 2-chloro-4-methoxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: XTPXWQSETPAFEV-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O3 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | tert-butyl 2-chloro-4-methoxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| InChIKey | XTPXWQSETPAFEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N=C(N=C2OC)Cl |
Computed by PubChem (NCBI)