CAS 312269-35-5 is the registry number for 2-[4-(2-Chloro-4-nitrophenyl)piperazin-1-yl]ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethanol (CAS 312269-35-5) is a chemical compound with the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. IUPAC name: 2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethanol. InChIKey: CSOGHWZVDGBXNY-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O3 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethanol |
| InChIKey | CSOGHWZVDGBXNY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)