Products 1158434-44-6

CAS 1158434-44-6 is the registry number for 2-Ethyl-1-methyl-1h-benzimidazol-5-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-ethyl-1-methylbenzimidazol-5-amine;dihydrochloride (CAS 1158434-44-6) is a chemical compound with the molecular formula C10H15Cl2N3 and a molecular weight of 248.15 g/mol. IUPAC name: 2-ethyl-1-methylbenzimidazol-5-amine;dihydrochloride. InChIKey: IVPRVTXYJCQXQP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15Cl2N3
Molecular weight248.15 g/mol
IUPAC name2-ethyl-1-methylbenzimidazol-5-amine;dihydrochloride
InChIKeyIVPRVTXYJCQXQP-UHFFFAOYSA-N
SMILESCCC1=NC2=C(N1C)C=CC(=C2)N.Cl.Cl

Computed by PubChem (NCBI)