CAS 2097936-93-9 is the registry number for 1-{imidazo[1,2-a]pyridin-3-yl}propan-2-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 250mg.
1-imidazo[1,2-a]pyridin-3-ylpropan-2-amine;dihydrochloride (CAS 2097936-93-9) is a chemical compound with the molecular formula C10H15Cl2N3 and a molecular weight of 248.15 g/mol. IUPAC name: 1-imidazo[1,2-a]pyridin-3-ylpropan-2-amine;dihydrochloride. InChIKey: ISCXHFUUOXMHKL-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3 |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 1-imidazo[1,2-a]pyridin-3-ylpropan-2-amine;dihydrochloride |
| InChIKey | ISCXHFUUOXMHKL-UHFFFAOYSA-N |
| SMILES | CC(CC1=CN=C2N1C=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)