CAS 1269053-76-0 appears in our catalog under these names: [(4,5-Dimethyl-1h-benzimidazol-2-yl)methyl]amine dihydrochloride, 95%, ((4,5-Dimethyl-1H-benzimidazol-2-yl)methyl)amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 1g, 5g.
(4,5-dimethyl-1H-benzimidazol-2-yl)methanamine;dihydrochloride (CAS 1269053-76-0) is a chemical compound with the molecular formula C10H15Cl2N3 and a molecular weight of 248.15 g/mol. IUPAC name: (4,5-dimethyl-1H-benzimidazol-2-yl)methanamine;dihydrochloride. InChIKey: GJPLEGUJLLVNCQ-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3 |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | (4,5-dimethyl-1H-benzimidazol-2-yl)methanamine;dihydrochloride |
| InChIKey | GJPLEGUJLLVNCQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CN)C.Cl.Cl |
Computed by PubChem (NCBI)