Products 1823044-68-3
CAS 1823044-68-3 appears in our catalog under these names: [3-(7H-Pyrrolo[2,3-b]pyridin-7-yl)propyl]amine dihydrochloride, 95%, (3-(7H-pyrrolo(2,3-b)pyridin-7-yl)propyl)amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-pyrrolo[2,3-b]pyridin-7-ylpropan-1-amine;dihydrochloride (CAS 1823044-68-3) is a chemical compound with the molecular formula C10H15Cl2N3 and a molecular weight of 248.15 g/mol. IUPAC name: 3-pyrrolo[2,3-b]pyridin-7-ylpropan-1-amine;dihydrochloride. InChIKey: OLIWZBRRGWEHGF-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N3 |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 3-pyrrolo[2,3-b]pyridin-7-ylpropan-1-amine;dihydrochloride |
| InChIKey | OLIWZBRRGWEHGF-UHFFFAOYSA-N |
| SMILES | C1=CN(C2=NC=CC2=C1)CCCN.Cl.Cl |
Computed by PubChem (NCBI)