Products 1158481-95-8

CAS 1158481-95-8 is the registry number for [1-Phenyl-2-(1h-pyrazol-1-yl)ethyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-phenyl-2-pyrazol-1-ylethanamine;dihydrochloride (CAS 1158481-95-8) is a chemical compound with the molecular formula C11H15Cl2N3 and a molecular weight of 260.16 g/mol. IUPAC name: 1-phenyl-2-pyrazol-1-ylethanamine;dihydrochloride. InChIKey: ATFCYZNNNLUGAS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15Cl2N3
Molecular weight260.16 g/mol
IUPAC name1-phenyl-2-pyrazol-1-ylethanamine;dihydrochloride
InChIKeyATFCYZNNNLUGAS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CN2C=CC=N2)N.Cl.Cl

Computed by PubChem (NCBI)