CAS 1185300-89-3 appears in our catalog under these names: 4-(3,5-Dimethyl-1h-pyrazol-1-yl)aniline dihydrochloride, 95%, 4-(3,5-Dimethyl-pyrazol-1-yl)-phenylaminedihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
4-(3,5-dimethylpyrazol-1-yl)aniline;dihydrochloride (CAS 1185300-89-3) is a chemical compound with the molecular formula C11H15Cl2N3 and a molecular weight of 260.16 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)aniline;dihydrochloride. InChIKey: BJVKACBNQKOGPM-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3 |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)aniline;dihydrochloride |
| InChIKey | BJVKACBNQKOGPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)N)C.Cl.Cl |
Computed by PubChem (NCBI)