CAS 1185298-38-7 is the registry number for N-Methyl-1-[4-(1H-pyrazol-1-yl)phenyl]methanamine dihydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-methyl-1-(4-pyrazol-1-ylphenyl)methanamine;dihydrochloride (CAS 1185298-38-7) is a chemical compound with the molecular formula C11H15Cl2N3 and a molecular weight of 260.16 g/mol. IUPAC name: N-methyl-1-(4-pyrazol-1-ylphenyl)methanamine;dihydrochloride. InChIKey: VOXTUGGGNPSTBL-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3 |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | N-methyl-1-(4-pyrazol-1-ylphenyl)methanamine;dihydrochloride |
| InChIKey | VOXTUGGGNPSTBL-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=C(C=C1)N2C=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)