Products 1427475-21-5
CAS 1427475-21-5 appears in our catalog under these names: 3-(Aminomethyl)-1-benzylpyrazole dihydrochloride, 95%, 3–(Aminomethyl)–1–benzylpyrazole Dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg, 5g.
(1-benzylpyrazol-3-yl)methanamine;dihydrochloride (CAS 1427475-21-5) is a chemical compound with the molecular formula C11H15Cl2N3 and a molecular weight of 260.16 g/mol. IUPAC name: (1-benzylpyrazol-3-yl)methanamine;dihydrochloride. InChIKey: OWPIRNDTOSHXQE-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3 |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (1-benzylpyrazol-3-yl)methanamine;dihydrochloride |
| InChIKey | OWPIRNDTOSHXQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)