Products 1158953-95-7

CAS 1158953-95-7 appears in our catalog under these names: 4-Fluoro-2-methyl-5-nitrobenzene-1-sulfonyl chloride, 95%, 4-Fluoro-2-methyl-5-nitrobenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-fluoro-2-methyl-5-nitrobenzenesulfonyl chloride (CAS 1158953-95-7) is a chemical compound with the molecular formula C7H5ClFNO4S and a molecular weight of 253.64 g/mol. IUPAC name: 4-fluoro-2-methyl-5-nitrobenzenesulfonyl chloride. InChIKey: MPXPLKCMUDUGGU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClFNO4S
Molecular weight253.64 g/mol
IUPAC name4-fluoro-2-methyl-5-nitrobenzenesulfonyl chloride
InChIKeyMPXPLKCMUDUGGU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])F

Computed by PubChem (NCBI)