Products 1820740-06-4
CAS 1820740-06-4 is the registry number for 1-Chloro-5-fluoro-4-methanesulfonyl-2-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-chloro-5-fluoro-4-methylsulfonyl-2-nitrobenzene (CAS 1820740-06-4) is a chemical compound with the molecular formula C7H5ClFNO4S and a molecular weight of 253.64 g/mol. IUPAC name: 1-chloro-5-fluoro-4-methylsulfonyl-2-nitrobenzene. InChIKey: CVLVOGWQQDPYGE-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO4S |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 1-chloro-5-fluoro-4-methylsulfonyl-2-nitrobenzene |
| InChIKey | CVLVOGWQQDPYGE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C(=C1)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)