Products 4793-22-0
CAS 4793-22-0 appears in our catalog under these names: 4–Chloro–2–fluoro–5–sulfamylbenzoic acid, 4-Chloro-2-fluoro-5-sulfamoylbenzoic acid, 98%, 4-Chloro-2-fluoro-5-sulfamylbenzoic acid, 96%, 4-Chloro-2-fluoro-5-sulfamoylbenzoic acid, 96%. Offered by: GLPBio, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
4-chloro-2-fluoro-5-sulfamoylbenzoic acid (CAS 4793-22-0) is a chemical compound with the molecular formula C7H5ClFNO4S and a molecular weight of 253.64 g/mol. IUPAC name: 4-chloro-2-fluoro-5-sulfamoylbenzoic acid. InChIKey: FDPTZONHYRXKLK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO4S |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 4-chloro-2-fluoro-5-sulfamoylbenzoic acid |
| InChIKey | FDPTZONHYRXKLK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)N)Cl)F)C(=O)O |
Computed by PubChem (NCBI)