Products 1803585-04-7

CAS 1803585-04-7 appears in our catalog under these names: 2-Fluoro-5-methyl-4-nitrobenzene-1-sulfonyl chloride, 95%, 2-Fluoro-5-methyl-4-nitrobenzenesulphonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-fluoro-5-methyl-4-nitrobenzenesulfonyl chloride (CAS 1803585-04-7) is a chemical compound with the molecular formula C7H5ClFNO4S and a molecular weight of 253.64 g/mol. IUPAC name: 2-fluoro-5-methyl-4-nitrobenzenesulfonyl chloride. InChIKey: WQKRETPWYPJFPV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClFNO4S
Molecular weight253.64 g/mol
IUPAC name2-fluoro-5-methyl-4-nitrobenzenesulfonyl chloride
InChIKeyWQKRETPWYPJFPV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1[N+](=O)[O-])F)S(=O)(=O)Cl

Computed by PubChem (NCBI)