CAS 11592-35-1 is the registry number for Boc-D-Tic-OH. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g.
(3S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (CAS 11592-35-1) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid. InChIKey: HFPVZPNLMJDJFB-LBPRGKRZSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3S)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| InChIKey | HFPVZPNLMJDJFB-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC=CC=C2C[C@H]1C(=O)O |
Computed by PubChem (NCBI)