CAS 1159511-79-1 is the registry number for 4-Bromo-1,7-dimethyl-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-bromo-1,7-dimethylindazole (CAS 1159511-79-1) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-1,7-dimethylindazole. InChIKey: DVFVSUZMEVFBPV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-1,7-dimethylindazole |
| InChIKey | DVFVSUZMEVFBPV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)C=NN2C |
Computed by PubChem (NCBI)