CAS 1159511-83-7 appears in our catalog under these names: 6-Bromo-1,5-dimethyl-1h-indazole, 98%, 6-Bromo-1,5-dimethyl-1H-indazole 96%, 6-Bromo-1,5-dimethyl-1H-indazole, 96%, 96%, 6-BROMO-1,5-DIMETHYL-1H-INDAZOLE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 2.5g.
6-bromo-1,5-dimethylindazole (CAS 1159511-83-7) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-1,5-dimethylindazole. InChIKey: WIZYXBZBDVQMCU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-1,5-dimethylindazole |
| InChIKey | WIZYXBZBDVQMCU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)N(N=C2)C |
Computed by PubChem (NCBI)