CAS 1159511-88-2 appears in our catalog under these names: 4-Bromo-2,7-dimethyl-2h-indazole, 95%, 4-BROMO-2,7-DIMETHYL-2H-INDAZOLE, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-bromo-2,7-dimethylindazole (CAS 1159511-88-2) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-2,7-dimethylindazole. InChIKey: YPDXDWNYMHERND-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-2,7-dimethylindazole |
| InChIKey | YPDXDWNYMHERND-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CN(N=C12)C)Br |
Computed by PubChem (NCBI)