CAS 1159511-89-3 appears in our catalog under these names: 5–bromo–2,4–dimethyl–2H–indazole, 5-Bromo-2,4-dimethyl-2H-indazole 95%, 5-Bromo-2,4-dimethyl-2H-indazole, 98%, 98%, 5-Bromo-2,4-dimethyl-2H-indazole, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
5-bromo-2,4-dimethylindazole (CAS 1159511-89-3) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 5-bromo-2,4-dimethylindazole. InChIKey: CJUCAYMTGYRYEH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 5-bromo-2,4-dimethylindazole |
| InChIKey | CJUCAYMTGYRYEH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=NN(C=C12)C)Br |
Computed by PubChem (NCBI)