CAS 1159609-95-6 appears in our catalog under these names: (1R,2S)–1–amino–2–vinylcyclopropanecarboxylic acid ethyl ester tosylate salt, (1R,2S)-Ethyl 1-amino-2-vinylcyclopropanecarboxylate 4-methylbenzenesulfonate, 98% mix TBC as stabilizer, 98% mix TBC as stabilizer, ETHYL (1R,2S)-1-AMINO-2-VINYLCYCLOPROPANE-1-CARBOXYLATE 4-METHYLBENZENESULFONATE, 97%, (1R,2S)-Ethyl 1-amino-2-vinylcyclopropanecarboxylate 4-methylbenzenesulfonate, 98% mix TBC as stabilizer. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 50mg, 100mg, 1g.
4-methylbenzenesulfonic acid;trans-ethyl (1R,2S)-1-amino-2-ethenylcyclopropane-1-carboxylate (CAS 1159609-95-6) is a chemical compound with the molecular formula C15H21NO5S and a molecular weight of 327.4 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;trans-ethyl (1R,2S)-1-amino-2-ethenylcyclopropane-1-carboxylate. InChIKey: ZVRWDUOPDWVUNQ-CIRBGYJCSA-N.
| Molecular formula | C15H21NO5S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;trans-ethyl (1R,2S)-1-amino-2-ethenylcyclopropane-1-carboxylate |
| InChIKey | ZVRWDUOPDWVUNQ-CIRBGYJCSA-N |
| SMILES | CCOC(=O)[C@]1(C[C@H]1C=C)N.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)