CAS 872107-72-7 appears in our catalog under these names: 3-(3,5-Dimethyl-piperidine-1-sulfonyl)-4-methoxy-benzoic acid, 95%, 3-((3,5-Dimethylpiperidin-1-yl)sulfonyl)-4-methoxybenzoic acid, 95%, 3-((3,5-Dimethylpiperidin-1-yl)sulfonyl)-4-methoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoic acid (CAS 872107-72-7) is a chemical compound with the molecular formula C15H21NO5S and a molecular weight of 327.4 g/mol. IUPAC name: 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoic acid. InChIKey: RNKHACHBXOIHPU-UHFFFAOYSA-N.
| Molecular formula | C15H21NO5S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzoic acid |
| InChIKey | RNKHACHBXOIHPU-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)OC)C |
Computed by PubChem (NCBI)